C18H21N4O7P — CID 118213565
[5-[4-(benzylamino)-7H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 118213565) has the molecular formula C18H21N4O7P and a molecular weight of 436.36 g/mol. Its IUPAC name is [5-[4-(benzylamino)-7H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [5-[4-(benzylamino)-7H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118213565 |
| Molecular Formula | C18H21N4O7P |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [5-[4-(benzylamino)-7H-pyrrolo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCC1OC(C2C=Nc3c(NCc4ccccc4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C18H21N4O7P/c23-15-12(8-28-30(25,26)27)29-17(16(15)24)11-7-19-14-13(11)21-9-22-18(14)20-6-10-4-2-1-3-5-10/h1-5,7,9,11-12,15-17,23-24H,6,8H2,(H,20,21,22)(H2,25,26,27) |
| InChIKey | ANIXDDSCDOMDLI-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 166.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|