C17H20N5O8P — CID 90450163
[(2R,3S,4R)-3,4-dihydroxy-5-[4-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90450163) has the molecular formula C17H20N5O8P and a molecular weight of 453.35 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-dihydroxy-5-[4-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R)-3,4-dihydroxy-5-[4-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90450163 |
| Molecular Formula | C17H20N5O8P |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [(2R,3S,4R)-3,4-dihydroxy-5-[4-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1OC(Oc2ccc(CNc3ncnc4nc[nH]c34)cc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H20N5O8P/c23-13-11(6-28-31(25,26)27)30-17(14(13)24)29-10-3-1-9(2-4-10)5-18-15-12-16(20-7-19-12)22-8-21-15/h1-4,7-8,11,13-14,17,23-24H,5-6H2,(H2,25,26,27)(H2,18,19,20,21,22)/t11-,13-,14-,17?/m1/s1 |
| InChIKey | CMFVUZBSXWGSIE-IKYDMHQPSA-N |
| XLogP | -0.10 |
| TPSA | 192.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|