C17H21N6O10P — CID 90449998
N-[(2-nitrophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90449998) has the molecular formula C17H21N6O10P and a molecular weight of 500.36 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | N-[(2-nitrophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90449998 |
| Molecular Formula | C17H21N6O10P |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | N-[(2-nitrophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1OC(O)[C@H](O)[C@@H]1O.O=[N+]([O-])c1ccccc1CNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C12H10N6O2.C5H11O8P/c19-18(20)9-4-2-1-3-8(9)5-13-11-10-12(15-6-14-10)17-7-16-11;6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h1-4,6-7H,5H2,(H2,13,14,15,16,17);2-8H,1H2,(H2,9,10,11)/t;2-,3-,4-,5?/m.1/s1 |
| InChIKey | XYPNFYUKDHYXFP-NWHVNECISA-N |
| XLogP | -0.59 |
| TPSA | 246.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|