C17H21BrN5O8P — CID 90450190
N-[(3-bromophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90450190) has the molecular formula C17H21BrN5O8P and a molecular weight of 534.26 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | N-[(3-bromophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90450190 |
| Molecular Formula | C17H21BrN5O8P |
| Molecular Weight | 534.26 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Brc1cccc(CNc2ncnc3nc[nH]c23)c1.O=P(O)(O)OC[C@H]1OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H10BrN5.C5H11O8P/c13-9-3-1-2-8(4-9)5-14-11-10-12(16-6-15-10)18-7-17-11;6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h1-4,6-7H,5H2,(H2,14,15,16,17,18);2-8H,1H2,(H2,9,10,11)/t;2-,3-,4-,5?/m.1/s1 |
| InChIKey | UORWJEZWPMTGLY-NWHVNECISA-N |
| XLogP | 0.26 |
| TPSA | 203.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|