C20H28N5O11P — CID 90450246
[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N-[(2,3,4-trimethoxyphenyl)methyl]-7H-purin-6-amine (PubChem CID 90450246) has the molecular formula C20H28N5O11P and a molecular weight of 545.44 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N-[(2,3,4-trimethoxyphenyl)methyl]-7H-purin-6-amine.
| Compound Name | [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N-[(2,3,4-trimethoxyphenyl)methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 90450246 |
| Molecular Formula | C20H28N5O11P |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate;N-[(2,3,4-trimethoxyphenyl)methyl]-7H-purin-6-amine |
| SMILES | COc1ccc(CNc2ncnc3nc[nH]c23)c(OC)c1OC.O=P(O)(O)OC[C@H]1OC(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H17N5O3.C5H11O8P/c1-21-10-5-4-9(12(22-2)13(10)23-3)6-16-14-11-15(18-7-17-11)20-8-19-14;6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h4-5,7-8H,6H2,1-3H3,(H2,16,17,18,19,20);2-8H,1H2,(H2,9,10,11)/t;2-,3-,4-,5?/m.1/s1 |
| InChIKey | PTEJUDNHXCYWDX-NWHVNECISA-N |
| XLogP | -0.47 |
| TPSA | 230.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|