C23H24ClFN9O7P — CID 71253643
N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 71253643) has the molecular formula C23H24ClFN9O7P and a molecular weight of 623.93 g/mol. Its IUPAC name is N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71253643 |
| Molecular Formula | C23H24ClFN9O7P |
| Molecular Weight | 623.93 g/mol |
| Exact Mass | 623.12 |
| IUPAC Name | N-[(2-chloro-6-fluoro-3-methylphenyl)methyl]-7H-purin-6-amine;[(2R,3S,4R,5R)-3,4-dihydroxy-5-purin-9-yloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1ccc(F)c(CNc2ncnc3nc[nH]c23)c1Cl.O=P(O)(O)OC[C@H]1O[C@@H](n2cnc3cncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H11ClFN5.C10H13N4O7P/c1-7-2-3-9(15)8(10(7)14)4-16-12-11-13(18-5-17-11)20-6-19-12;15-7-6(2-20-22(17,18)19)21-10(8(7)16)14-4-13-5-1-11-3-12-9(5)14/h2-3,5-6H,4H2,1H3,(H2,16,17,18,19,20);1,3-4,6-8,10,15-16H,2H2,(H2,17,18,19)/t;6-,7-,8-,10-/m.1/s1 |
| InChIKey | NINIMWVFGGOUJE-WSVRLGEUSA-N |
| XLogP | 1.62 |
| TPSA | 226.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.93 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|