C18H22N5O10P — CID 90450387
[(2R,3S,4R)-3,4-dihydroxy-5-[4-hydroxy-2-methoxy-5-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 90450387) has the molecular formula C18H22N5O10P and a molecular weight of 499.37 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-dihydroxy-5-[4-hydroxy-2-methoxy-5-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R)-3,4-dihydroxy-5-[4-hydroxy-2-methoxy-5-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90450387 |
| Molecular Formula | C18H22N5O10P |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | [(2R,3S,4R)-3,4-dihydroxy-5-[4-hydroxy-2-methoxy-5-[(7H-purin-6-ylamino)methyl]phenoxy]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | COc1cc(O)c(CNc2ncnc3nc[nH]c23)cc1OC1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H22N5O10P/c1-30-10-3-9(24)8(4-19-16-13-17(21-6-20-13)23-7-22-16)2-11(10)32-18-15(26)14(25)12(33-18)5-31-34(27,28)29/h2-3,6-7,12,14-15,18,24-26H,4-5H2,1H3,(H2,27,28,29)(H2,19,20,21,22,23)/t12-,14-,15-,18?/m1/s1 |
| InChIKey | YIELGUJHNKCAFL-PZGKNFOESA-N |
| XLogP | -0.39 |
| TPSA | 221.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|