C19H23N3O10P2 — CID 155228280
[[(2R,3S,4R,5S)-5-[4-(benzylamino)furo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155228280) has the molecular formula C19H23N3O10P2 and a molecular weight of 515.35 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[4-(benzylamino)furo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[4-(benzylamino)furo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155228280 |
| Molecular Formula | C19H23N3O10P2 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[4-(benzylamino)furo[3,2-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](c2coc3c(NCc4ccccc4)ncnc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23N3O10P2/c23-15-13(8-31-34(28,29)10-33(25,26)27)32-17(16(15)24)12-7-30-18-14(12)21-9-22-19(18)20-6-11-4-2-1-3-5-11/h1-5,7,9,13,15-17,23-24H,6,8,10H2,(H,28,29)(H,20,21,22)(H2,25,26,27)/t13-,15-,16-,17+/m1/s1 |
| InChIKey | VGFJICPFMSAROI-DZUCGIPZSA-N |
| XLogP | 1.33 |
| TPSA | 204.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|