C8H13FN3O13P3 — CID 25059201
[2-[(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)methoxy]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 25059201) has the molecular formula C8H13FN3O13P3 and a molecular weight of 471.12 g/mol. Its IUPAC name is [2-[(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)methoxy]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [2-[(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)methoxy]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 25059201 |
| Molecular Formula | C8H13FN3O13P3 |
| Molecular Weight | 471.12 g/mol |
| Exact Mass | 470.96 |
| IUPAC Name | [2-[(3-carbamoyl-5-fluoro-2-oxopyrazin-1-yl)methoxy]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(=O)c1nc(F)cn(COCCOP(=O)(O)OP(=O)(O)OP(=O)(O)O)c1=O |
| InChI | InChI=1S/C8H13FN3O13P3/c9-5-3-12(8(14)6(11-5)7(10)13)4-22-1-2-23-27(18,19)25-28(20,21)24-26(15,16)17/h3H,1-2,4H2,(H2,10,13)(H,18,19)(H,20,21)(H2,15,16,17) |
| InChIKey | DOCBSELANAJBQC-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 247.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.12 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|