C41H48ClNO14 — CID 160706686
benzyl 2-(2-chloro-2-oxoethoxy)acetate;methyl (2S)-8-oxo-9-(2-oxo-2-phenylmethoxyethoxy)-2-[[2-(2-oxo-2-phenylmethoxyethoxy)acetyl]amino]nonanoate (PubChem CID 160706686) has the molecular formula C41H48ClNO14 and a molecular weight of 814.28 g/mol. Its IUPAC name is benzyl 2-(2-chloro-2-oxoethoxy)acetate;methyl (2S)-8-oxo-9-(2-oxo-2-phenylmethoxyethoxy)-2-[[2-(2-oxo-2-phenylmethoxyethoxy)acetyl]amino]nonanoate.
| Compound Name | benzyl 2-(2-chloro-2-oxoethoxy)acetate;methyl (2S)-8-oxo-9-(2-oxo-2-phenylmethoxyethoxy)-2-[[2-(2-oxo-2-phenylmethoxyethoxy)acetyl]amino]nonanoate |
|---|---|
| PubChem CID | 160706686 |
| Molecular Formula | C41H48ClNO14 |
| Molecular Weight | 814.28 g/mol |
| Exact Mass | 813.28 |
| IUPAC Name | benzyl 2-(2-chloro-2-oxoethoxy)acetate;methyl (2S)-8-oxo-9-(2-oxo-2-phenylmethoxyethoxy)-2-[[2-(2-oxo-2-phenylmethoxyethoxy)acetyl]amino]nonanoate |
| SMILES | COC(=O)[C@H](CCCCCC(=O)COCC(=O)OCc1ccccc1)NC(=O)COCC(=O)OCc1ccccc1.O=C(Cl)COCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H37NO10.C11H11ClO4/c1-37-30(36)26(31-27(33)20-39-22-29(35)41-18-24-13-7-3-8-14-24)16-10-4-9-15-25(32)19-38-21-28(34)40-17-23-11-5-2-6-12-23;12-10(13)7-15-8-11(14)16-6-9-4-2-1-3-5-9/h2-3,5-8,11-14,26H,4,9-10,15-22H2,1H3,(H,31,33);1-5H,6-8H2/t26-;/m0./s1 |
| InChIKey | RRHXVISFSMTYOG-SNYZSRNZSA-N |
| XLogP | 4.20 |
| TPSA | 196.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|