C42H26N2S — CID 160716391
4-(12,12-dimethylfluoreno[1,2-b][1]benzothiol-8-yl)-3-(3-isocyano-9H-fluoren-9-yl)benzonitrile (PubChem CID 160716391) has the molecular formula C42H26N2S and a molecular weight of 590.75 g/mol. Its IUPAC name is 4-(12,12-dimethylfluoreno[1,2-b][1]benzothiol-8-yl)-3-(3-isocyano-9H-fluoren-9-yl)benzonitrile.
| Compound Name | 4-(12,12-dimethylfluoreno[1,2-b][1]benzothiol-8-yl)-3-(3-isocyano-9H-fluoren-9-yl)benzonitrile |
|---|---|
| PubChem CID | 160716391 |
| Molecular Formula | C42H26N2S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 4-(12,12-dimethylfluoreno[1,2-b][1]benzothiol-8-yl)-3-(3-isocyano-9H-fluoren-9-yl)benzonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1ccccc1C2c1cc(C#N)ccc1-c1ccc2sc3c4c(ccc3c2c1)-c1ccccc1C4(C)C |
| InChI | InChI=1S/C42H26N2S/c1-42(2)37-11-7-6-9-29(37)32-17-18-33-35-21-25(13-19-38(35)45-41(33)40(32)42)27-15-12-24(23-43)20-36(27)39-30-10-5-4-8-28(30)34-22-26(44-3)14-16-31(34)39/h4-22,39H,1-2H3 |
| InChIKey | MKHFBDHOHSBBOM-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|