About (2-cyanophenyl)boronic acid;ethanol
(2-cyanophenyl)boronic acid;ethanol (PubChem CID 160719925) has the molecular formula C9H12BNO3
and a molecular weight of 193.01 g/mol. Its IUPAC name is (2-cyanophenyl)boronic acid;ethanol.
Molecular Properties
| Compound Name | (2-cyanophenyl)boronic acid;ethanol |
| PubChem CID | 160719925 |
| Molecular Formula | C9H12BNO3 |
| Molecular Weight | 193.01 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2-cyanophenyl)boronic acid;ethanol |
| SMILES | CCO.N#Cc1ccccc1B(O)O |
| InChI | InChI=1S/C7H6BNO2.C2H6O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2-3/h1-4,10-11H;3H,2H2,1H3 |
| InChIKey | RSYVPWKKCSBIPM-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.01 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanophenyl)boronic acid;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl)boronic acid;ethanol?
The IUPAC name of (2-cyanophenyl)boronic acid;ethanol (CID 160719925) is (2-cyanophenyl)boronic acid;ethanol.
What is the SMILES notation for (2-cyanophenyl)boronic acid;ethanol?
The canonical SMILES for (2-cyanophenyl)boronic acid;ethanol is CCO.N#Cc1ccccc1B(O)O.
What is the InChIKey of (2-cyanophenyl)boronic acid;ethanol?
The InChIKey is RSYVPWKKCSBIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BNO2.C2H6O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2-3/h1-4,10-11H;3H,2H2,1H3.
What are the key properties of (2-cyanophenyl)boronic acid;ethanol?
(2-cyanophenyl)boronic acid;ethanol has a molecular weight of 193.01 g/mol, XLogP of -0.76, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)boronic acid;ethanol is sourced from PubChem (CID 160719925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).