C19H18F4O2 — CID 160741286
3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde (PubChem CID 160741286) has the molecular formula C19H18F4O2 and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde.
| Compound Name | 3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 160741286 |
| Molecular Formula | C19H18F4O2 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde |
| SMILES | CC(C)c1cc(C=O)cc(F)c1-c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F4O2/c1-11(2)15-8-12(10-24)9-16(20)17(15)13-4-6-14(7-5-13)18(3,25)19(21,22)23/h4-11,25H,1-3H3 |
| InChIKey | WXUDPPKFVGZUBJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|