C38H35F9O4 — CID 160741285
2,3-difluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde;3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde (PubChem CID 160741285) has the molecular formula C38H35F9O4 and a molecular weight of 726.68 g/mol. Its IUPAC name is 2,3-difluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde;3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde.
| Compound Name | 2,3-difluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde;3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 160741285 |
| Molecular Formula | C38H35F9O4 |
| Molecular Weight | 726.68 g/mol |
| Exact Mass | 726.24 |
| IUPAC Name | 2,3-difluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde;3-fluoro-5-propan-2-yl-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]benzaldehyde |
| SMILES | CC(C)c1cc(C=O)c(F)c(F)c1-c1ccc(C(C)(O)C(F)(F)F)cc1.CC(C)c1cc(C=O)cc(F)c1-c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F5O2.C19H18F4O2/c1-10(2)14-8-12(9-25)16(20)17(21)15(14)11-4-6-13(7-5-11)18(3,26)19(22,23)24;1-11(2)15-8-12(10-24)9-16(20)17(15)13-4-6-14(7-5-13)18(3,25)19(21,22)23/h4-10,26H,1-3H3;4-11,25H,1-3H3 |
| InChIKey | RVPSFHIXZFXJPA-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.68 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|