C19H14F8O2 — CID 139491672
2,3-difluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-propan-2-ylbenzaldehyde (PubChem CID 139491672) has the molecular formula C19H14F8O2 and a molecular weight of 426.30 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-propan-2-ylbenzaldehyde.
| Compound Name | 2,3-difluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-propan-2-ylbenzaldehyde |
|---|---|
| PubChem CID | 139491672 |
| Molecular Formula | C19H14F8O2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2,3-difluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-propan-2-ylbenzaldehyde |
| SMILES | CC(C)c1cc(C=O)c(F)c(F)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F8O2/c1-9(2)13-7-11(8-28)15(20)16(21)14(13)10-3-5-12(6-4-10)17(29,18(22,23)24)19(25,26)27/h3-9,29H,1-2H3 |
| InChIKey | FIJFAXOSZLPOJE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|