C43H78O6 — CID 160745065
2-bicyclo[2.2.1]heptanylmethyl 2,2-dimethylbutanoate;2-cyclohexylethyl 2,2-dimethylbutanoate;3-cyclohexylpropyl 2,2-dimethylbutanoate (PubChem CID 160745065) has the molecular formula C43H78O6 and a molecular weight of 691.09 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethyl 2,2-dimethylbutanoate;2-cyclohexylethyl 2,2-dimethylbutanoate;3-cyclohexylpropyl 2,2-dimethylbutanoate.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethyl 2,2-dimethylbutanoate;2-cyclohexylethyl 2,2-dimethylbutanoate;3-cyclohexylpropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 160745065 |
| Molecular Formula | C43H78O6 |
| Molecular Weight | 691.09 g/mol |
| Exact Mass | 690.58 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethyl 2,2-dimethylbutanoate;2-cyclohexylethyl 2,2-dimethylbutanoate;3-cyclohexylpropyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CC2CCC1C2.CCC(C)(C)C(=O)OCCC1CCCCC1.CCC(C)(C)C(=O)OCCCC1CCCCC1 |
| InChI | InChI=1S/C15H28O2.C14H24O2.C14H26O2/c1-4-15(2,3)14(16)17-12-8-11-13-9-6-5-7-10-13;1-4-14(2,3)13(15)16-9-12-8-10-5-6-11(12)7-10;1-4-14(2,3)13(15)16-11-10-12-8-6-5-7-9-12/h13H,4-12H2,1-3H3;10-12H,4-9H2,1-3H3;12H,4-11H2,1-3H3 |
| InChIKey | RWCATUBBSZEAEU-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.09 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|