C39H52BrN5O4 — CID 160770388
5-bromo-2-(1-ethoxyethyl)pyridine;4-[4-[[6-(1-ethoxyethyl)-3-pyridinyl]methyl]phenyl]morpholine;4-morpholin-4-ylaniline (PubChem CID 160770388) has the molecular formula C39H52BrN5O4 and a molecular weight of 734.78 g/mol. Its IUPAC name is 5-bromo-2-(1-ethoxyethyl)pyridine;4-[4-[[6-(1-ethoxyethyl)-3-pyridinyl]methyl]phenyl]morpholine;4-morpholin-4-ylaniline.
| Compound Name | 5-bromo-2-(1-ethoxyethyl)pyridine;4-[4-[[6-(1-ethoxyethyl)-3-pyridinyl]methyl]phenyl]morpholine;4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 160770388 |
| Molecular Formula | C39H52BrN5O4 |
| Molecular Weight | 734.78 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | 5-bromo-2-(1-ethoxyethyl)pyridine;4-[4-[[6-(1-ethoxyethyl)-3-pyridinyl]methyl]phenyl]morpholine;4-morpholin-4-ylaniline |
| SMILES | CCOC(C)c1ccc(Br)cn1.CCOC(C)c1ccc(Cc2ccc(N3CCOCC3)cc2)cn1.Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H26N2O2.C10H14N2O.C9H12BrNO/c1-3-24-16(2)20-9-6-18(15-21-20)14-17-4-7-19(8-5-17)22-10-12-23-13-11-22;11-9-1-3-10(4-2-9)12-5-7-13-8-6-12;1-3-12-7(2)9-5-4-8(10)6-11-9/h4-9,15-16H,3,10-14H2,1-2H3;1-4H,5-8,11H2;4-7H,3H2,1-2H3 |
| InChIKey | RZFVNIFLSCGMCA-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.78 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|