C32H66N2OS — CID 160780859
2,3,4-tritert-butylmorpholine;2,3,4-tritert-butylthiomorpholine (PubChem CID 160780859) has the molecular formula C32H66N2OS and a molecular weight of 526.96 g/mol. Its IUPAC name is 2,3,4-tritert-butylmorpholine;2,3,4-tritert-butylthiomorpholine.
| Compound Name | 2,3,4-tritert-butylmorpholine;2,3,4-tritert-butylthiomorpholine |
|---|---|
| PubChem CID | 160780859 |
| Molecular Formula | C32H66N2OS |
| Molecular Weight | 526.96 g/mol |
| Exact Mass | 526.49 |
| IUPAC Name | 2,3,4-tritert-butylmorpholine;2,3,4-tritert-butylthiomorpholine |
| SMILES | CC(C)(C)C1OCCN(C(C)(C)C)C1C(C)(C)C.CC(C)(C)C1SCCN(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C16H33NO.C16H33NS/c2*1-14(2,3)12-13(15(4,5)6)18-11-10-17(12)16(7,8)9/h2*12-13H,10-11H2,1-9H3 |
| InChIKey | SAOAZMYSFNKPSZ-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.96 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |