C24H30N3O2Si+ — CID 160792592
4-(10-methyl-2-morpholin-4-ium-4-ylidene-10-prop-2-enylbenzo[b][1,4]benzazasilin-8-yl)morpholine (PubChem CID 160792592) has the molecular formula C24H30N3O2Si+ and a molecular weight of 420.61 g/mol. Its IUPAC name is 4-(10-methyl-2-morpholin-4-ium-4-ylidene-10-prop-2-enylbenzo[b][1,4]benzazasilin-8-yl)morpholine.
| Compound Name | 4-(10-methyl-2-morpholin-4-ium-4-ylidene-10-prop-2-enylbenzo[b][1,4]benzazasilin-8-yl)morpholine |
|---|---|
| PubChem CID | 160792592 |
| Molecular Formula | C24H30N3O2Si+ |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-(10-methyl-2-morpholin-4-ium-4-ylidene-10-prop-2-enylbenzo[b][1,4]benzazasilin-8-yl)morpholine |
| SMILES | C=CC[Si]1(C)C2=CC(=[N+]3CCOCC3)C=CC2=Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C24H30N3O2Si/c1-3-16-30(2)23-17-19(26-8-12-28-13-9-26)4-6-21(23)25-22-7-5-20(18-24(22)30)27-10-14-29-15-11-27/h3-7,17-18H,1,8-16H2,2H3/q+1 |
| InChIKey | YMZFRDWNONDCGJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|