C27H31N2O2+ — CID 18737625
4-[4-[(Z)-[3-[(4-morpholin-4-ium-4-ylidenecyclohexa-2,5-dien-1-ylidene)methyl]cyclopent-2-en-1-ylidene]methyl]phenyl]morpholine (PubChem CID 18737625) has the molecular formula C27H31N2O2+ and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-[4-[(Z)-[3-[(4-morpholin-4-ium-4-ylidenecyclohexa-2,5-dien-1-ylidene)methyl]cyclopent-2-en-1-ylidene]methyl]phenyl]morpholine.
| Compound Name | 4-[4-[(Z)-[3-[(4-morpholin-4-ium-4-ylidenecyclohexa-2,5-dien-1-ylidene)methyl]cyclopent-2-en-1-ylidene]methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 18737625 |
| Molecular Formula | C27H31N2O2+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 4-[4-[(Z)-[3-[(4-morpholin-4-ium-4-ylidenecyclohexa-2,5-dien-1-ylidene)methyl]cyclopent-2-en-1-ylidene]methyl]phenyl]morpholine |
| SMILES | C1=CC(=[N+]2CCOCC2)C=CC1=CC1=C/C(=C\c2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C27H31N2O2/c1-2-25(20-23-5-9-27(10-6-23)29-13-17-31-18-14-29)21-24(1)19-22-3-7-26(8-4-22)28-11-15-30-16-12-28/h3-10,19-21H,1-2,11-18H2/q+1 |
| InChIKey | TUOHFBAPBTZWEZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|