C22H28N3O2Si+ — CID 157112878
4-(10,10-dimethyl-2-morpholin-4-ium-4-ylidenebenzo[b][1,4]benzazasilin-8-yl)morpholine (PubChem CID 157112878) has the molecular formula C22H28N3O2Si+ and a molecular weight of 394.57 g/mol. Its IUPAC name is 4-(10,10-dimethyl-2-morpholin-4-ium-4-ylidenebenzo[b][1,4]benzazasilin-8-yl)morpholine.
| Compound Name | 4-(10,10-dimethyl-2-morpholin-4-ium-4-ylidenebenzo[b][1,4]benzazasilin-8-yl)morpholine |
|---|---|
| PubChem CID | 157112878 |
| Molecular Formula | C22H28N3O2Si+ |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 4-(10,10-dimethyl-2-morpholin-4-ium-4-ylidenebenzo[b][1,4]benzazasilin-8-yl)morpholine |
| SMILES | C[Si]1(C)C2=CC(=[N+]3CCOCC3)C=CC2=Nc2ccc(N3CCOCC3)cc21 |
| InChI | InChI=1S/C22H28N3O2Si/c1-28(2)21-15-17(24-7-11-26-12-8-24)3-5-19(21)23-20-6-4-18(16-22(20)28)25-9-13-27-14-10-25/h3-6,15-16H,7-14H2,1-2H3/q+1 |
| InChIKey | HJFRXJPQCKQPPI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 37.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|