About benzamide;naphthalene-2-sulfonamide
benzamide;naphthalene-2-sulfonamide (PubChem CID 160825471) has the molecular formula C17H16N2O3S
and a molecular weight of 328.39 g/mol. Its IUPAC name is benzamide;naphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | benzamide;naphthalene-2-sulfonamide |
| PubChem CID | 160825471 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | benzamide;naphthalene-2-sulfonamide |
| SMILES | NC(=O)c1ccccc1.NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H9NO2S.C7H7NO/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;8-7(9)6-4-2-1-3-5-6/h1-7H,(H2,11,12,13);1-5H,(H2,8,9) |
| InChIKey | SGCHDURETQYTSH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzamide;naphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;naphthalene-2-sulfonamide?
The IUPAC name of benzamide;naphthalene-2-sulfonamide (CID 160825471) is benzamide;naphthalene-2-sulfonamide.
What is the SMILES notation for benzamide;naphthalene-2-sulfonamide?
The canonical SMILES for benzamide;naphthalene-2-sulfonamide is NC(=O)c1ccccc1.NS(=O)(=O)c1ccc2ccccc2c1.
What is the InChIKey of benzamide;naphthalene-2-sulfonamide?
The InChIKey is SGCHDURETQYTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S.C7H7NO/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;8-7(9)6-4-2-1-3-5-6/h1-7H,(H2,11,12,13);1-5H,(H2,8,9).
What are the key properties of benzamide;naphthalene-2-sulfonamide?
benzamide;naphthalene-2-sulfonamide has a molecular weight of 328.39 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;naphthalene-2-sulfonamide is sourced from PubChem (CID 160825471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).