C11H11ClN2O4 — CID 160838277
imidazolidine-2,4-dione;2-phenoxyacetyl chloride (PubChem CID 160838277) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is imidazolidine-2,4-dione;2-phenoxyacetyl chloride.
| Compound Name | imidazolidine-2,4-dione;2-phenoxyacetyl chloride |
|---|---|
| PubChem CID | 160838277 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | imidazolidine-2,4-dione;2-phenoxyacetyl chloride |
| SMILES | O=C(Cl)COc1ccccc1.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C8H7ClO2.C3H4N2O2/c9-8(10)6-11-7-4-2-1-3-5-7;6-2-1-4-3(7)5-2/h1-5H,6H2;1H2,(H2,4,5,6,7) |
| InChIKey | SHRODSZRAIBSED-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|