C39H43N5O4 — CID 160838422
3,15-diazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione;3,15,22-triazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione (PubChem CID 160838422) has the molecular formula C39H43N5O4 and a molecular weight of 645.80 g/mol. Its IUPAC name is 3,15-diazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione;3,15,22-triazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione.
| Compound Name | 3,15-diazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione;3,15,22-triazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione |
|---|---|
| PubChem CID | 160838422 |
| Molecular Formula | C39H43N5O4 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | 3,15-diazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione;3,15,22-triazatricyclo[15.2.2.15,9]docosa-1(20),5,7,9(22),17(21),18-hexaene-4,14-dione |
| SMILES | O=C1CCCCc2cccc(c2)C(=O)NCc2ccc(cc2)CN1.O=C1CCCCc2cccc(n2)C(=O)NCc2ccc(cc2)CN1 |
| InChI | InChI=1S/C20H22N2O2.C19H21N3O2/c23-19-7-2-1-4-15-5-3-6-18(12-15)20(24)22-14-17-10-8-16(9-11-17)13-21-19;23-18-7-2-1-4-16-5-3-6-17(22-16)19(24)21-13-15-10-8-14(9-11-15)12-20-18/h3,5-6,8-12H,1-2,4,7,13-14H2,(H,21,23)(H,22,24);3,5-6,8-11H,1-2,4,7,12-13H2,(H,20,23)(H,21,24) |
| InChIKey | SHRXVMZCGFGTPN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |