C14H16N4O — CID 175861405
3,4,7,18-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one (PubChem CID 175861405) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 3,4,7,18-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one.
| Compound Name | 3,4,7,18-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one |
|---|---|
| PubChem CID | 175861405 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3,4,7,18-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one |
| SMILES | O=C1CCCCCc2cccc(n2)-c2[nH]ncc2N1 |
| InChI | InChI=1S/C14H16N4O/c19-13-8-3-1-2-5-10-6-4-7-11(16-10)14-12(17-13)9-15-18-14/h4,6-7,9H,1-3,5,8H2,(H,15,18)(H,17,19) |
| InChIKey | LSPPETNYDBJMMP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |