C18H18N4O3S — CID 160844671
3-(5-ethyl-1,2-thiazol-3-yl)aniline;3-nitrobenzamide (PubChem CID 160844671) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-(5-ethyl-1,2-thiazol-3-yl)aniline;3-nitrobenzamide.
| Compound Name | 3-(5-ethyl-1,2-thiazol-3-yl)aniline;3-nitrobenzamide |
|---|---|
| PubChem CID | 160844671 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-(5-ethyl-1,2-thiazol-3-yl)aniline;3-nitrobenzamide |
| SMILES | CCc1cc(-c2cccc(N)c2)ns1.NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N2S.C7H6N2O3/c1-2-10-7-11(13-14-10)8-4-3-5-9(12)6-8;8-7(10)5-2-1-3-6(4-5)9(11)12/h3-7H,2,12H2,1H3;1-4H,(H2,8,10) |
| InChIKey | SIMHSZGBZJIMQA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|