C20H17N5O9 — CID 139198477
3-aminobenzoic acid;3,5-dinitrobenzoic acid;pyridine-4-carboxamide (PubChem CID 139198477) has the molecular formula C20H17N5O9 and a molecular weight of 471.38 g/mol. Its IUPAC name is 3-aminobenzoic acid;3,5-dinitrobenzoic acid;pyridine-4-carboxamide.
| Compound Name | 3-aminobenzoic acid;3,5-dinitrobenzoic acid;pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139198477 |
| Molecular Formula | C20H17N5O9 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 3-aminobenzoic acid;3,5-dinitrobenzoic acid;pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccncc1.Nc1cccc(C(=O)O)c1.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4N2O6.C7H7NO2.C6H6N2O/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;8-6-3-1-2-5(4-6)7(9)10;7-6(9)5-1-3-8-4-2-5/h1-3H,(H,10,11);1-4H,8H2,(H,9,10);1-4H,(H2,7,9) |
| InChIKey | LZOQFHRNSXERJJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 242.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|