C17H14N4O6 — CID 158350856
4-methyl-2-(3-nitrophenyl)-1,3-oxazole;3-nitrobenzamide (PubChem CID 158350856) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is 4-methyl-2-(3-nitrophenyl)-1,3-oxazole;3-nitrobenzamide.
| Compound Name | 4-methyl-2-(3-nitrophenyl)-1,3-oxazole;3-nitrobenzamide |
|---|---|
| PubChem CID | 158350856 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 4-methyl-2-(3-nitrophenyl)-1,3-oxazole;3-nitrobenzamide |
| SMILES | Cc1coc(-c2cccc([N+](=O)[O-])c2)n1.NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H8N2O3.C7H6N2O3/c1-7-6-15-10(11-7)8-3-2-4-9(5-8)12(13)14;8-7(10)5-2-1-3-6(4-5)9(11)12/h2-6H,1H3;1-4H,(H2,8,10) |
| InChIKey | GSHLCKJWFXKVGZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 155.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|