C17H24N8O6 — CID 160861792
tert-butyl N-(2,6-dimethyl-5-nitropyrimidin-4-yl)carbamate;2,6-dimethyl-5-nitropyrimidin-4-amine (PubChem CID 160861792) has the molecular formula C17H24N8O6 and a molecular weight of 436.43 g/mol. Its IUPAC name is tert-butyl N-(2,6-dimethyl-5-nitropyrimidin-4-yl)carbamate;2,6-dimethyl-5-nitropyrimidin-4-amine.
| Compound Name | tert-butyl N-(2,6-dimethyl-5-nitropyrimidin-4-yl)carbamate;2,6-dimethyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 160861792 |
| Molecular Formula | C17H24N8O6 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | tert-butyl N-(2,6-dimethyl-5-nitropyrimidin-4-yl)carbamate;2,6-dimethyl-5-nitropyrimidin-4-amine |
| SMILES | Cc1nc(C)c([N+](=O)[O-])c(N)n1.Cc1nc(C)c([N+](=O)[O-])c(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C11H16N4O4.C6H8N4O2/c1-6-8(15(17)18)9(13-7(2)12-6)14-10(16)19-11(3,4)5;1-3-5(10(11)12)6(7)9-4(2)8-3/h1-5H3,(H,12,13,14,16);1-2H3,(H2,7,8,9) |
| InChIKey | SKOWYUVMNYHESJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 202.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|