C16H15ClO2 — CID 160874160
1,1'-biphenyl;1,4-dioxine;hydrochloride (PubChem CID 160874160) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 1,1'-biphenyl;1,4-dioxine;hydrochloride.
| Compound Name | 1,1'-biphenyl;1,4-dioxine;hydrochloride |
|---|---|
| PubChem CID | 160874160 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1,1'-biphenyl;1,4-dioxine;hydrochloride |
| SMILES | C1=COC=CO1.Cl.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H4O2.ClH/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-4-3-5-1;/h1-10H;1-4H;1H |
| InChIKey | MFXAZQJAZIEETQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |