C5H15ClO8 — CID 160891587
ethanol;perchloric acid;propane-1,2,3-triol (PubChem CID 160891587) has the molecular formula C5H15ClO8 and a molecular weight of 238.62 g/mol. Its IUPAC name is ethanol;perchloric acid;propane-1,2,3-triol.
| Compound Name | ethanol;perchloric acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 160891587 |
| Molecular Formula | C5H15ClO8 |
| Molecular Weight | 238.62 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | ethanol;perchloric acid;propane-1,2,3-triol |
| SMILES | CCO.OCC(O)CO.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C3H8O3.C2H6O.ClHO4/c4-1-3(6)2-5;1-2-3;2-1(3,4)5/h3-6H,1-2H2;3H,2H2,1H3;(H,2,3,4,5) |
| InChIKey | SOIMODSWPCPXOQ-UHFFFAOYSA-N |
| XLogP | -5.79 |
| TPSA | 170.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.62 |
| LogP ≤ 5 | -5.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |