About (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine
(2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine (PubChem CID 160893517) has the molecular formula C22H18BBr3N2O2
and a molecular weight of 592.92 g/mol. Its IUPAC name is (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine.
Molecular Properties
| Compound Name | (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine |
| PubChem CID | 160893517 |
| Molecular Formula | C22H18BBr3N2O2 |
| Molecular Weight | 592.92 g/mol |
| Exact Mass | 589.90 |
| IUPAC Name | (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine |
| SMILES | Brc1ccccc1-c1ccccn1.Brc1ccccn1.OB(O)c1ccccc1Br |
| InChI | InChI=1S/C11H8BrN.C6H6BBrO2.C5H4BrN/c12-10-6-2-1-5-9(10)11-7-3-4-8-13-11;8-6-4-2-1-3-5(6)7(9)10;6-5-3-1-2-4-7-5/h1-8H;1-4,9-10H;1-4H |
| InChIKey | SOOQSVHBKNGJGO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine?
The IUPAC name of (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine (CID 160893517) is (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine.
What is the SMILES notation for (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine?
The canonical SMILES for (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine is Brc1ccccc1-c1ccccn1.Brc1ccccn1.OB(O)c1ccccc1Br.
What is the InChIKey of (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine?
The InChIKey is SOOQSVHBKNGJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN.C6H6BBrO2.C5H4BrN/c12-10-6-2-1-5-9(10)11-7-3-4-8-13-11;8-6-4-2-1-3-5(6)7(9)10;6-5-3-1-2-4-7-5/h1-8H;1-4,9-10H;1-4H.
What are the key properties of (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine?
(2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine has a molecular weight of 592.92 g/mol, XLogP of 5.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)boronic acid;2-(2-bromophenyl)pyridine;2-bromopyridine is sourced from PubChem (CID 160893517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).