C67H46BBr4N5O2 — CID 160526722
(4-pyridin-2-ylphenyl)boronic acid;1,2,4,5-tetrabromobenzene;2-[4-[2,4,5-tris(4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine (PubChem CID 160526722) has the molecular formula C67H46BBr4N5O2 and a molecular weight of 1283.57 g/mol. Its IUPAC name is (4-pyridin-2-ylphenyl)boronic acid;1,2,4,5-tetrabromobenzene;2-[4-[2,4,5-tris(4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine.
| Compound Name | (4-pyridin-2-ylphenyl)boronic acid;1,2,4,5-tetrabromobenzene;2-[4-[2,4,5-tris(4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 160526722 |
| Molecular Formula | C67H46BBr4N5O2 |
| Molecular Weight | 1283.57 g/mol |
| Exact Mass | 1279.05 |
| IUPAC Name | (4-pyridin-2-ylphenyl)boronic acid;1,2,4,5-tetrabromobenzene;2-[4-[2,4,5-tris(4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine |
| SMILES | Brc1cc(Br)c(Br)cc1Br.OB(O)c1ccc(-c2ccccn2)cc1.c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccn5)cc4)c(-c4ccc(-c5ccccn5)cc4)cc3-c3ccc(-c4ccccn4)cc3)cc2)nc1 |
| InChI | InChI=1S/C50H34N4.C11H10BNO2.C6H2Br4/c1-5-29-51-47(9-1)39-21-13-35(14-22-39)43-33-45(37-17-25-41(26-18-37)49-11-3-7-31-53-49)46(38-19-27-42(28-20-38)50-12-4-8-32-54-50)34-44(43)36-15-23-40(24-16-36)48-10-2-6-30-52-48;14-12(15)10-6-4-9(5-7-10)11-3-1-2-8-13-11;7-3-1-4(8)6(10)2-5(3)9/h1-34H;1-8,14-15H;1-2H |
| InChIKey | QUZPUQRXLIDLEA-UHFFFAOYSA-N |
| XLogP | 17.77 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1283.57 |
| LogP ≤ 5 | 17.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|