C67H49BBr4O2 — CID 159460743
(4-methylphenyl)boronic acid;1,3,6,8-tetrabromopyrene;1,3,6,8-tetrakis(4-methylphenyl)pyrene (PubChem CID 159460743) has the molecular formula C67H49BBr4O2 and a molecular weight of 1216.55 g/mol. Its IUPAC name is (4-methylphenyl)boronic acid;1,3,6,8-tetrabromopyrene;1,3,6,8-tetrakis(4-methylphenyl)pyrene.
| Compound Name | (4-methylphenyl)boronic acid;1,3,6,8-tetrabromopyrene;1,3,6,8-tetrakis(4-methylphenyl)pyrene |
|---|---|
| PubChem CID | 159460743 |
| Molecular Formula | C67H49BBr4O2 |
| Molecular Weight | 1216.55 g/mol |
| Exact Mass | 1212.06 |
| IUPAC Name | (4-methylphenyl)boronic acid;1,3,6,8-tetrabromopyrene;1,3,6,8-tetrakis(4-methylphenyl)pyrene |
| SMILES | Brc1cc(Br)c2ccc3c(Br)cc(Br)c4ccc1c2c43.Cc1ccc(-c2cc(-c3ccc(C)cc3)c3ccc4c(-c5ccc(C)cc5)cc(-c5ccc(C)cc5)c5ccc2c3c54)cc1.Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C44H34.C16H6Br4.C7H9BO2/c1-27-5-13-31(14-6-27)39-25-40(32-15-7-28(2)8-16-32)36-23-24-38-42(34-19-11-30(4)12-20-34)26-41(33-17-9-29(3)10-18-33)37-22-21-35(39)43(36)44(37)38;17-11-5-13(19)9-3-4-10-14(20)6-12(18)8-2-1-7(11)15(9)16(8)10;1-6-2-4-7(5-3-6)8(9)10/h5-26H,1-4H3;1-6H;2-5,9-10H,1H3 |
| InChIKey | LUOHMDOIDUCKPD-UHFFFAOYSA-N |
| XLogP | 19.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1216.55 |
| LogP ≤ 5 | 19.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|