C20H16F6O2 — CID 160920692
(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol;(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-one (PubChem CID 160920692) has the molecular formula C20H16F6O2 and a molecular weight of 402.33 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol;(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol;(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 160920692 |
| Molecular Formula | C20H16F6O2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-phenylbut-3-en-2-ol;(E)-1,1,1-trifluoro-4-phenylbut-3-en-2-one |
| SMILES | O=C(/C=C/c1ccccc1)C(F)(F)F.OC(/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O.C10H7F3O/c2*11-10(12,13)9(14)7-6-8-4-2-1-3-5-8/h1-7,9,14H;1-7H/b2*7-6+ |
| InChIKey | SRZHNCLLBWXQRU-YIKKBJQVSA-N |
| XLogP | 5.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|