C16H26N2O3 — CID 160926267
1-tert-butylpyrrole;1-[(2-methylpropan-2-yl)oxy]pyrrolidine-2,5-dione (PubChem CID 160926267) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-tert-butylpyrrole;1-[(2-methylpropan-2-yl)oxy]pyrrolidine-2,5-dione.
| Compound Name | 1-tert-butylpyrrole;1-[(2-methylpropan-2-yl)oxy]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 160926267 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-tert-butylpyrrole;1-[(2-methylpropan-2-yl)oxy]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)ON1C(=O)CCC1=O.CC(C)(C)n1cccc1 |
| InChI | InChI=1S/C8H13NO3.C8H13N/c1-8(2,3)12-9-6(10)4-5-7(9)11;1-8(2,3)9-6-4-5-7-9/h4-5H2,1-3H3;4-7H,1-3H3 |
| InChIKey | SSRHPGMCAUTOHQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|