C29H44N2O10S4 — CID 160940446
carbon dioxide;N-(2-ethylsulfanylethyl)-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethylsulfanylmethyl formate (PubChem CID 160940446) has the molecular formula C29H44N2O10S4 and a molecular weight of 708.94 g/mol. Its IUPAC name is carbon dioxide;N-(2-ethylsulfanylethyl)-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethylsulfanylmethyl formate.
| Compound Name | carbon dioxide;N-(2-ethylsulfanylethyl)-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethylsulfanylmethyl formate |
|---|---|
| PubChem CID | 160940446 |
| Molecular Formula | C29H44N2O10S4 |
| Molecular Weight | 708.94 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | carbon dioxide;N-(2-ethylsulfanylethyl)-4-methoxy-N,2,6-trimethylbenzenesulfonamide;2-[(4-methoxy-2,6-dimethylphenyl)sulfonyl-methylamino]ethylsulfanylmethyl formate |
| SMILES | CCSCCN(C)S(=O)(=O)c1c(C)cc(OC)cc1C.COc1cc(C)c(S(=O)(=O)N(C)CCSCOC=O)c(C)c1.O=C=O |
| InChI | InChI=1S/C14H21NO5S2.C14H23NO3S2.CO2/c1-11-7-13(19-4)8-12(2)14(11)22(17,18)15(3)5-6-21-10-20-9-16;1-6-19-8-7-15(4)20(16,17)14-11(2)9-13(18-5)10-12(14)3;2-1-3/h7-9H,5-6,10H2,1-4H3;9-10H,6-8H2,1-5H3; |
| InChIKey | SULBQEAVAIFEGH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 153.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|