C22H26O4Si — CID 160947135
methyl (E)-9-trimethylsilylnon-2-en-6,8-diynoate;(E)-non-2-en-6,8-diynoic acid (PubChem CID 160947135) has the molecular formula C22H26O4Si and a molecular weight of 382.53 g/mol. Its IUPAC name is methyl (E)-9-trimethylsilylnon-2-en-6,8-diynoate;(E)-non-2-en-6,8-diynoic acid.
| Compound Name | methyl (E)-9-trimethylsilylnon-2-en-6,8-diynoate;(E)-non-2-en-6,8-diynoic acid |
|---|---|
| PubChem CID | 160947135 |
| Molecular Formula | C22H26O4Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | methyl (E)-9-trimethylsilylnon-2-en-6,8-diynoate;(E)-non-2-en-6,8-diynoic acid |
| SMILES | C#CC#CCC/C=C/C(=O)O.COC(=O)/C=C/CCC#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C13H18O2Si.C9H8O2/c1-15-13(14)11-9-7-5-6-8-10-12-16(2,3)4;1-2-3-4-5-6-7-8-9(10)11/h9,11H,5,7H2,1-4H3;1,7-8H,5-6H2,(H,10,11)/b11-9+;8-7+ |
| InChIKey | SVGOXMASQQQHLR-CSRSNBMGSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|