C33H33N5O10 — CID 160947720
3-(4-carboxyphenyl)-5-[(1E,3E,5E)-5-[1-(4-carboxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-2,6-dioxopyrimidin-4-olate;triethylazanium (PubChem CID 160947720) has the molecular formula C33H33N5O10 and a molecular weight of 659.65 g/mol. Its IUPAC name is 3-(4-carboxyphenyl)-5-[(1E,3E,5E)-5-[1-(4-carboxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-2,6-dioxopyrimidin-4-olate;triethylazanium.
| Compound Name | 3-(4-carboxyphenyl)-5-[(1E,3E,5E)-5-[1-(4-carboxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-2,6-dioxopyrimidin-4-olate;triethylazanium |
|---|---|
| PubChem CID | 160947720 |
| Molecular Formula | C33H33N5O10 |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.22 |
| IUPAC Name | 3-(4-carboxyphenyl)-5-[(1E,3E,5E)-5-[1-(4-carboxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]penta-1,3-dienyl]-2,6-dioxopyrimidin-4-olate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=C1NC(=O)N(c2ccc(C(=O)O)cc2)C(=O)/C1=C/C=C/C=C/c1c([O-])n(-c2ccc(C(=O)O)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H18N4O10.C6H15N/c32-20-18(22(34)30(26(40)28-20)16-10-6-14(7-11-16)24(36)37)4-2-1-3-5-19-21(33)29-27(41)31(23(19)35)17-12-8-15(9-13-17)25(38)39;1-4-7(5-2)6-3/h1-13,34H,(H,36,37)(H,38,39)(H,28,32,40)(H,29,33,41);4-6H2,1-3H3/b3-1+,4-2+,19-5+; |
| InChIKey | SVIKCJOKVNJLFI-LSXYEEOFSA-N |
| XLogP | 0.71 |
| TPSA | 223.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|