C25H18N4O6 — CID 14273769
(5E)-5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-2,4-dienylidene]-1-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 14273769) has the molecular formula C25H18N4O6 and a molecular weight of 470.44 g/mol. Its IUPAC name is (5E)-5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-2,4-dienylidene]-1-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-2,4-dienylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 14273769 |
| Molecular Formula | C25H18N4O6 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (5E)-5-[(2E,4E)-5-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)penta-2,4-dienylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2)C(=O)/C1=C/C=C/C=C/c1c(O)n(-c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H18N4O6/c30-20-18(22(32)28(24(34)26-20)16-10-4-1-5-11-16)14-8-3-9-15-19-21(31)27-25(35)29(23(19)33)17-12-6-2-7-13-17/h1-15,32H,(H,26,30,34)(H,27,31,35)/b9-3+,14-8+,19-15+ |
| InChIKey | IKVFOVRLYWSAQZ-GLBDIXCZSA-N |
| XLogP | 2.01 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|