About CID 160957814
CID 160957814 (PubChem CID 160957814) has the molecular formula C7H6BN2O
and a molecular weight of 144.95 g/mol.
Molecular Properties
| Compound Name | CID 160957814 |
| PubChem CID | 160957814 |
| Molecular Formula | C7H6BN2O |
| Molecular Weight | 144.95 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | — |
| SMILES | N#Cc1ccccc1N[B]O |
| InChI | InChI=1S/C7H6BN2O/c9-5-6-3-1-2-4-7(6)10-8-11/h1-4,10-11H |
| InChIKey | UCXICOSKYSVCKH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.95 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 160957814 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160957814?
The IUPAC name of CID 160957814 (CID 160957814) is not available.
What is the SMILES notation for CID 160957814?
The canonical SMILES for CID 160957814 is N#Cc1ccccc1N[B]O.
What is the InChIKey of CID 160957814?
The InChIKey is UCXICOSKYSVCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BN2O/c9-5-6-3-1-2-4-7(6)10-8-11/h1-4,10-11H.
What are the key properties of CID 160957814?
CID 160957814 has a molecular weight of 144.95 g/mol, XLogP of 0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160957814 is sourced from PubChem (CID 160957814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).