C21H20F3N3O3 — CID 160962388
N-(3-cyano-4-fluorophenyl)-4-[(4R)-5,5-difluoro-4-methyl-2-oxohexanoyl]-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 160962388) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-4-[(4R)-5,5-difluoro-4-methyl-2-oxohexanoyl]-1,5-dimethylpyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-4-[(4R)-5,5-difluoro-4-methyl-2-oxohexanoyl]-1,5-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 160962388 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-4-[(4R)-5,5-difluoro-4-methyl-2-oxohexanoyl]-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)C[C@@H](C)C(C)(F)F)cc(C(=O)Nc2ccc(F)c(C#N)c2)n1C |
| InChI | InChI=1S/C21H20F3N3O3/c1-11(21(3,23)24)7-18(28)19(29)15-9-17(27(4)12(15)2)20(30)26-14-5-6-16(22)13(8-14)10-25/h5-6,8-9,11H,7H2,1-4H3,(H,26,30)/t11-/m1/s1 |
| InChIKey | TUDAQQDYDXLUMA-LLVKDONJSA-N |
| XLogP | 4.03 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|