C32H40BBrO8 — CID 160967033
2-(3,6-dihydro-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methyl 4-bromobenzoate;methyl 4-(3,6-dihydro-2H-pyran-4-yl)benzoate (PubChem CID 160967033) has the molecular formula C32H40BBrO8 and a molecular weight of 643.38 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methyl 4-bromobenzoate;methyl 4-(3,6-dihydro-2H-pyran-4-yl)benzoate.
| Compound Name | 2-(3,6-dihydro-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methyl 4-bromobenzoate;methyl 4-(3,6-dihydro-2H-pyran-4-yl)benzoate |
|---|---|
| PubChem CID | 160967033 |
| Molecular Formula | C32H40BBrO8 |
| Molecular Weight | 643.38 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;methyl 4-bromobenzoate;methyl 4-(3,6-dihydro-2H-pyran-4-yl)benzoate |
| SMILES | CC1(C)OB(C2=CCOCC2)OC1(C)C.COC(=O)c1ccc(Br)cc1.COC(=O)c1ccc(C2=CCOCC2)cc1 |
| InChI | InChI=1S/C13H14O3.C11H19BO3.C8H7BrO2/c1-15-13(14)12-4-2-10(3-5-12)11-6-8-16-9-7-11;1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9;1-11-8(10)6-2-4-7(9)5-3-6/h2-6H,7-9H2,1H3;5H,6-8H2,1-4H3;2-5H,1H3 |
| InChIKey | SXTJJNPKKIAHLQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.38 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|