C18H32F4O10 — CID 160969019
1-[3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]-3-(2-hydroxyethoxy)propan-2-ol (PubChem CID 160969019) has the molecular formula C18H32F4O10 and a molecular weight of 484.44 g/mol. Its IUPAC name is 1-[3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]-3-(2-hydroxyethoxy)propan-2-ol.
| Compound Name | 1-[3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]-3-(2-hydroxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 160969019 |
| Molecular Formula | C18H32F4O10 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-[3-[2-[[2-(1,1-difluoro-2-prop-2-enoxyethoxy)-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]-3-(2-hydroxyethoxy)propan-2-ol |
| SMILES | C=CCOCC(F)(F)OC(F)(F)COCOCCOCC(O)COCC(O)COCCO |
| InChI | InChI=1S/C18H32F4O10/c1-2-4-28-12-17(19,20)32-18(21,22)13-31-14-29-7-6-27-9-16(25)11-30-10-15(24)8-26-5-3-23/h2,15-16,23-25H,1,3-14H2 |
| InChIKey | SXZYVPGTBOEWKD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|