C17H20ClNO3S2 — CID 160973143
1-[5-chloro-2-(5-phenylpentyl)-1,3-thiazol-4-yl]-2-methylsulfonylethanone (PubChem CID 160973143) has the molecular formula C17H20ClNO3S2 and a molecular weight of 385.94 g/mol. Its IUPAC name is 1-[5-chloro-2-(5-phenylpentyl)-1,3-thiazol-4-yl]-2-methylsulfonylethanone.
| Compound Name | 1-[5-chloro-2-(5-phenylpentyl)-1,3-thiazol-4-yl]-2-methylsulfonylethanone |
|---|---|
| PubChem CID | 160973143 |
| Molecular Formula | C17H20ClNO3S2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 1-[5-chloro-2-(5-phenylpentyl)-1,3-thiazol-4-yl]-2-methylsulfonylethanone |
| SMILES | CS(=O)(=O)CC(=O)c1nc(CCCCCc2ccccc2)sc1Cl |
| InChI | InChI=1S/C17H20ClNO3S2/c1-24(21,22)12-14(20)16-17(18)23-15(19-16)11-7-3-6-10-13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-12H2,1H3 |
| InChIKey | SYNDUZCDOMNVBT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|