C13H22N2O7 — CID 160976351
2-aminohexanedioic acid;methyl (2R)-6-oxopiperidine-2-carboxylate (PubChem CID 160976351) has the molecular formula C13H22N2O7 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-aminohexanedioic acid;methyl (2R)-6-oxopiperidine-2-carboxylate.
| Compound Name | 2-aminohexanedioic acid;methyl (2R)-6-oxopiperidine-2-carboxylate |
|---|---|
| PubChem CID | 160976351 |
| Molecular Formula | C13H22N2O7 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-aminohexanedioic acid;methyl (2R)-6-oxopiperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCC(=O)N1.NC(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO3.C6H11NO4/c1-11-7(10)5-3-2-4-6(9)8-5;7-4(6(10)11)2-1-3-5(8)9/h5H,2-4H2,1H3,(H,8,9);4H,1-3,7H2,(H,8,9)(H,10,11)/t5-;/m1./s1 |
| InChIKey | SYXOTYDDNHFPGG-NUBCRITNSA-N |
| XLogP | -0.52 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |