C34H33FeNO2P2 — CID 160983641
cyclopenta-1,3-diene;2-[2-di(furan-1-ium-2-id-2-yl)phosphanyl-3-diphenylphosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethylethanamine;iron(2+) (PubChem CID 160983641) has the molecular formula C34H33FeNO2P2 and a molecular weight of 605.44 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-[2-di(furan-1-ium-2-id-2-yl)phosphanyl-3-diphenylphosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethylethanamine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-[2-di(furan-1-ium-2-id-2-yl)phosphanyl-3-diphenylphosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethylethanamine;iron(2+) |
|---|---|
| PubChem CID | 160983641 |
| Molecular Formula | C34H33FeNO2P2 |
| Molecular Weight | 605.44 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | cyclopenta-1,3-diene;2-[2-di(furan-1-ium-2-id-2-yl)phosphanyl-3-diphenylphosphanylcyclopenta-1,4-dien-1-yl]-N,N-dimethylethanamine;iron(2+) |
| SMILES | CN(C)CCc1cc[c-](P(c2ccccc2)c2ccccc2)c1P([c-]1ccc[o+]1)[c-]1ccc[o+]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C29H28NO2P2.C5H5.Fe/c1-30(2)20-19-23-17-18-26(29(23)34(27-15-9-21-31-27)28-16-10-22-32-28)33(24-11-5-3-6-12-24)25-13-7-4-8-14-25;1-2-4-5-3-1;/h3-18,21-22H,19-20H2,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | SZVIBXLIERGEJY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 25.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|