C20H47N2O8P — CID 160986605
3-(2-aminoethylamino)propane-1,1,1,3-tetrol;2,2,11-trimethyldodecan-3-yl dihydrogen phosphate (PubChem CID 160986605) has the molecular formula C20H47N2O8P and a molecular weight of 474.58 g/mol. Its IUPAC name is 3-(2-aminoethylamino)propane-1,1,1,3-tetrol;2,2,11-trimethyldodecan-3-yl dihydrogen phosphate.
| Compound Name | 3-(2-aminoethylamino)propane-1,1,1,3-tetrol;2,2,11-trimethyldodecan-3-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 160986605 |
| Molecular Formula | C20H47N2O8P |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 3-(2-aminoethylamino)propane-1,1,1,3-tetrol;2,2,11-trimethyldodecan-3-yl dihydrogen phosphate |
| SMILES | CC(C)CCCCCCCC(OP(=O)(O)O)C(C)(C)C.NCCNC(O)CC(O)(O)O |
| InChI | InChI=1S/C15H33O4P.C5H14N2O4/c1-13(2)11-9-7-6-8-10-12-14(15(3,4)5)19-20(16,17)18;6-1-2-7-4(8)3-5(9,10)11/h13-14H,6-12H2,1-5H3,(H2,16,17,18);4,7-11H,1-3,6H2 |
| InChIKey | TUBGFJSVIVACQD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 185.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|