(E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid

C14H28O3 — CID 161004203

IUPAC(E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid
SMILESC.CC(=O)/C(C)=C/C(C)C.CC(C)CC(=O)O
InChIInChI=1S/C8H14O.C5H10O2.CH4/c1-6(2)5-7(3)8(4)9;1-4(2)3-5(6)7;/h5-6H,1-4H3;4H,3H2,1-2H3,(H,6,7);1H4/b7-5+;;
InChIKeyTWHDJCYXNXZFDH-WVKUUHRJSA-N
MW244.38 g/mol
LogP3.93
Rot. Bonds4

About (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid

(E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid (PubChem CID 161004203) has the molecular formula C14H28O3 and a molecular weight of 244.38 g/mol. Its IUPAC name is (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid.

Molecular Properties

Compound Name(E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid
PubChem CID161004203
Molecular FormulaC14H28O3
Molecular Weight244.38 g/mol
Exact Mass244.20
IUPAC Name(E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid
SMILESC.CC(=O)/C(C)=C/C(C)C.CC(C)CC(=O)O
InChIInChI=1S/C8H14O.C5H10O2.CH4/c1-6(2)5-7(3)8(4)9;1-4(2)3-5(6)7;/h5-6H,1-4H3;4H,3H2,1-2H3,(H,6,7);1H4/b7-5+;;
InChIKeyTWHDJCYXNXZFDH-WVKUUHRJSA-N
XLogP3.93
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.38
LogP ≤ 53.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid?
The IUPAC name of (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid (CID 161004203) is (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid.
What is the SMILES notation for (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid?
The canonical SMILES for (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid is C.CC(=O)/C(C)=C/C(C)C.CC(C)CC(=O)O.
What is the InChIKey of (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid?
The InChIKey is TWHDJCYXNXZFDH-WVKUUHRJSA-N. The full InChI is InChI=1S/C8H14O.C5H10O2.CH4/c1-6(2)5-7(3)8(4)9;1-4(2)3-5(6)7;/h5-6H,1-4H3;4H,3H2,1-2H3,(H,6,7);1H4/b7-5+;;.
What are the key properties of (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid?
(E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid has a molecular weight of 244.38 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid is sourced from PubChem (CID 161004203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).