C14H28O3 — CID 161004203
(E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid (PubChem CID 161004203) has the molecular formula C14H28O3 and a molecular weight of 244.38 g/mol. Its IUPAC name is (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid.
| Compound Name | (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid |
|---|---|
| PubChem CID | 161004203 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | (E)-3,5-dimethylhex-3-en-2-one;methane;3-methylbutanoic acid |
| SMILES | C.CC(=O)/C(C)=C/C(C)C.CC(C)CC(=O)O |
| InChI | InChI=1S/C8H14O.C5H10O2.CH4/c1-6(2)5-7(3)8(4)9;1-4(2)3-5(6)7;/h5-6H,1-4H3;4H,3H2,1-2H3,(H,6,7);1H4/b7-5+;; |
| InChIKey | TWHDJCYXNXZFDH-WVKUUHRJSA-N |
| XLogP | 3.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|