C11H20O2 — CID 91315796
5-hydroxy-3,8-dimethylnon-3-en-2-one (PubChem CID 91315796) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-hydroxy-3,8-dimethylnon-3-en-2-one.
| Compound Name | 5-hydroxy-3,8-dimethylnon-3-en-2-one |
|---|---|
| PubChem CID | 91315796 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5-hydroxy-3,8-dimethylnon-3-en-2-one |
| SMILES | CC(=O)C(C)=CC(O)CCC(C)C |
| InChI | InChI=1S/C11H20O2/c1-8(2)5-6-11(13)7-9(3)10(4)12/h7-8,11,13H,5-6H2,1-4H3 |
| InChIKey | ZOWUQHYITYCHPB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|